Products 1940-31-4

CAS 1940-31-4 is the registry number for N-Acetyl 2-bromo-4,5-dichloroaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

N-(2-bromo-4,5-dichlorophenyl)acetamide (CAS 1940-31-4) is a chemical compound with the molecular formula C8H6BrCl2NO and a molecular weight of 282.95 g/mol. IUPAC name: N-(2-bromo-4,5-dichlorophenyl)acetamide. InChIKey: VIWRGBIBHKQAPZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrCl2NO
Molecular weight282.95 g/mol
IUPAC nameN-(2-bromo-4,5-dichlorophenyl)acetamide
InChIKeyVIWRGBIBHKQAPZ-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC(=C(C=C1Br)Cl)Cl

Computed by PubChem (NCBI)