CAS 1940-31-4 is the registry number for N-Acetyl 2-bromo-4,5-dichloroaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
N-(2-bromo-4,5-dichlorophenyl)acetamide (CAS 1940-31-4) is a chemical compound with the molecular formula C8H6BrCl2NO and a molecular weight of 282.95 g/mol. IUPAC name: N-(2-bromo-4,5-dichlorophenyl)acetamide. InChIKey: VIWRGBIBHKQAPZ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrCl2NO |
|---|---|
| Molecular weight | 282.95 g/mol |
| IUPAC name | N-(2-bromo-4,5-dichlorophenyl)acetamide |
| InChIKey | VIWRGBIBHKQAPZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C=C1Br)Cl)Cl |
Computed by PubChem (NCBI)