cas: 31793-29-0 — see every product listed under this CAS number, including other names
4-Amino-3,5-dinitropyridine 98% (CAS 31793-29-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A260702-1g |
| cas | 31793-29-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 25g | 431.56 Pln | |
| Ambeed | 100g | 1482.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A260702 |
3,5-dinitropyridin-4-amine (CAS 31793-29-0) is a chemical compound with the molecular formula C5H4N4O4 and a molecular weight of 184.11 g/mol. IUPAC name: 3,5-dinitropyridin-4-amine. InChIKey: IEUQRKITTGSLJL-UHFFFAOYSA-N.
| Molecular formula | C5H4N4O4 |
|---|---|
| Molecular weight | 184.11 g/mol |
| IUPAC name | 3,5-dinitropyridin-4-amine |
| InChIKey | IEUQRKITTGSLJL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)[N+](=O)[O-])N)[N+](=O)[O-] |
Computed by PubChem (NCBI)