cas: 400-76-0 — see every product listed under this CAS number, including other names
4-Amino-3-(trifluoromethyl)benzoic acid, 95%, 95% (CAS 400-76-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C601-1g |
| cas | 400-76-0 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 261.20 Pln | |
| Chemat | 10g | 419.60 Pln | |
| Chemat | 25g | 784.40 Pln | |
| Chemat | 50g | 1418.00 Pln | |
| Chemat | 100g | 2709.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-amino-3-(trifluoromethyl)benzoic acid (CAS 400-76-0) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 4-amino-3-(trifluoromethyl)benzoic acid. InChIKey: NPPPORJZPNJXNQ-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 4-amino-3-(trifluoromethyl)benzoic acid |
| InChIKey | NPPPORJZPNJXNQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(F)(F)F)N |
Computed by PubChem (NCBI)