4-Amino-3-(trifluoromethyl)benzoic acid, 95%
cas: 400-76-0 — see every product listed under this CAS number, including other names
4-Amino-3-(trifluoromethyl)benzoic acid, 95% (CAS 400-76-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A186683-1g |
| cas | 400-76-0 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 214.62 Pln | |
| Ambeed | 10g | 348.12 Pln | |
| Ambeed | 25g | 598.44 Pln | |
| Ambeed | 100g | 1961.25 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 364.34 Pln | |
| BLDpharm | 10g | 608.70 Pln | |
| BLDpharm | 25g | 1141.84 Pln | |
| BLDpharm | 100g | 3829.79 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 261.20 Pln | |
| Chemat | 10g | 419.60 Pln | |
| Chemat | 25g | 784.40 Pln | |
| Chemat | 50g | 1418.00 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 461.31 Pln | |
| Fluorochem | 25g | 1455.76 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-amino-3-(trifluoromethyl)benzoic acid (CAS 400-76-0) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 4-amino-3-(trifluoromethyl)benzoic acid. InChIKey: NPPPORJZPNJXNQ-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 4-amino-3-(trifluoromethyl)benzoic acid |
| InChIKey | NPPPORJZPNJXNQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(F)(F)F)N |
Computed by PubChem (NCBI)
Synonyms:
4-amino-3-(trifluoromethyl)benzoic acid, 4-Amino-3-trifluoromethylbenzoic acid, 4-amino-5-trifluoromethylbenzoic acid, 4-Amino-3-trifluoromethylbenzioc acid, 4-Amino-3-trifluoromethyl benzoic acid, 4-Amino-3-(Trifluoromethyl)Benzoic Acid 3-Trifluoromethyl-4-Aminobenzoic Acid, Benzoic acid, 4-amino-3-(trifluoromethyl)-, 4-Amino-alpha,alpha,alpha-trifluoro-m-toluic Acid;, 4-amino-3-(trifluoromethyl)benzoicacid, 4-Amino-3-trifluoromethyl-benzoic acid