cas: 852569-35-8 — see every product listed under this CAS number, including other names
4-Amino-5-iodo-2-(trifluoromethyl)benzonitrile, 97% (CAS 852569-35-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A857100-100mg |
| cas | 852569-35-8 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 128.59 Pln | |
| AmBeed | 10g | 5037.13 Pln | |
| AmBeed | 250mg | 200.20 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-amino-5-iodo-2-(trifluoromethyl)benzonitrile (CAS 852569-35-8) is a chemical compound with the molecular formula C8H4F3IN2 and a molecular weight of 312.03 g/mol. IUPAC name: 4-amino-5-iodo-2-(trifluoromethyl)benzonitrile. InChIKey: RJRDPZZROCNGCH-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IN2 |
|---|---|
| Molecular weight | 312.03 g/mol |
| IUPAC name | 4-amino-5-iodo-2-(trifluoromethyl)benzonitrile |
| InChIKey | RJRDPZZROCNGCH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1I)N)C(F)(F)F)C#N |
Computed by PubChem (NCBI)