cas: 33509-43-2 — see every product listed under this CAS number, including other names
4-Amino-6-(tert-butyl)-3-mercapto-1,2,4-triazin-5(4H)-one, 97% (CAS 33509-43-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F547924-1G |
| cas | 33509-43-2 |
| size | 1g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 476.93 Pln | |
| Fluorochem | 25g | 1513.03 Pln | |
| Fluorochem | 100g | 4449.49 Pln | |
| Fluorochem | 500g | 20178.33 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 470.50 Pln | |
| Ambeed | 25g | 1477.31 Pln | |
| Ambeed | 100g | 4364.25 Pln | |
| Ambeed | 500g | 20072.75 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-amino-6-tert-butyl-3-sulfanylidene-2H-1,2,4-triazin-5-one (CAS 33509-43-2) is a chemical compound with the molecular formula C7H12N4OS and a molecular weight of 200.26 g/mol. IUPAC name: 4-amino-6-tert-butyl-3-sulfanylidene-2H-1,2,4-triazin-5-one. InChIKey: OFKAVNQBCRJBJE-UHFFFAOYSA-N.
| Molecular formula | C7H12N4OS |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 4-amino-6-tert-butyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| InChIKey | OFKAVNQBCRJBJE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NNC(=S)N(C1=O)N |
Computed by PubChem (NCBI)