CAS 33509-43-2 appears in our catalog under these names: 4-Amino-6-(tert-butyl)-3-mercapto-4,5-dihydro-1,2,4-triazin-5-one, >95% (HPLC), 4-Amino-6-(1,1-dimethylethyl)-3,4-dihydro-3-thioxo-1,2,4-triazin-5(2H)-one, 97%, 97%, 4-Amino-6-(tert-butyl)-3-mercapto-1,2,4-triazin-5(4H)-one, 97%. Offered by: TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 10mg, 50mg, 10g, 50g, 1g, 5g, 25g.
4-amino-6-tert-butyl-3-sulfanylidene-2H-1,2,4-triazin-5-one (CAS 33509-43-2) is a chemical compound with the molecular formula C7H12N4OS and a molecular weight of 200.26 g/mol. IUPAC name: 4-amino-6-tert-butyl-3-sulfanylidene-2H-1,2,4-triazin-5-one. InChIKey: OFKAVNQBCRJBJE-UHFFFAOYSA-N.
| Molecular formula | C7H12N4OS |
|---|---|
| Molecular weight | 200.26 g/mol |
| IUPAC name | 4-amino-6-tert-butyl-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| InChIKey | OFKAVNQBCRJBJE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NNC(=S)N(C1=O)N |
Computed by PubChem (NCBI)