cas: 862470-14-2 — see every product listed under this CAS number, including other names
4-Amino-N,N,2-trimethylbenzamide 95% (CAS 862470-14-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1136276-100mg |
| cas | 862470-14-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 604.00 Pln | |
| Ambeed | 1g | 1249.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1136276 |
4-amino-N,N,2-trimethylbenzamide (CAS 862470-14-2) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: 4-amino-N,N,2-trimethylbenzamide. InChIKey: DPYZPMBEYWHIDM-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 4-amino-N,N,2-trimethylbenzamide |
| InChIKey | DPYZPMBEYWHIDM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)C(=O)N(C)C |
Computed by PubChem (NCBI)