CAS 1161012-23-2 is the registry number for 2-Amino-N,N-dimethyl-2-phenylacetamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-amino-N,N-dimethyl-2-phenylacetamide (CAS 1161012-23-2) is a chemical compound with the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. IUPAC name: 2-amino-N,N-dimethyl-2-phenylacetamide. InChIKey: FYEBKMCUIFSZNT-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2-amino-N,N-dimethyl-2-phenylacetamide |
| InChIKey | FYEBKMCUIFSZNT-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C(C1=CC=CC=C1)N |
Computed by PubChem (NCBI)