cas: 51207-85-3 — see every product listed under this CAS number, including other names
4-Amino-N,N-diethylbenzamide, 98% (CAS 51207-85-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210174-250MG |
| cas | 51207-85-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 508.17 Pln | |
| Fluorochem | 5g | 1346.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-amino-N,N-diethylbenzamide (CAS 51207-85-3) is a chemical compound with the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. IUPAC name: 4-amino-N,N-diethylbenzamide. InChIKey: RNVOPVJRSRXPSX-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 4-amino-N,N-diethylbenzamide |
| InChIKey | RNVOPVJRSRXPSX-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)