cas: 1709-39-3 — see every product listed under this CAS number, including other names
4-Amino-N,N-diethylbenzenesulfonamide, 95%, 95% (CAS 1709-39-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11APQO-250mg |
| cas | 1709-39-3 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 381.20 Pln | |
| Chemat | 10g | 602.00 Pln | |
| Chemat | 25g | 1163.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-amino-N,N-diethylbenzenesulfonamide (CAS 1709-39-3) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 228.31 g/mol. IUPAC name: 4-amino-N,N-diethylbenzenesulfonamide. InChIKey: LTFVELCIFWEGGA-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 4-amino-N,N-diethylbenzenesulfonamide |
| InChIKey | LTFVELCIFWEGGA-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)