cas: 1709-39-3 — see every product listed under this CAS number, including other names
4-Amino-N,N-diethylbenzenesulfonamide (CAS 1709-39-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037409-1G |
| cas | 1709-39-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 706.02 Pln |
| delivery time | 2-3 weeks |
|---|
4-amino-N,N-diethylbenzenesulfonamide (CAS 1709-39-3) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 228.31 g/mol. IUPAC name: 4-amino-N,N-diethylbenzenesulfonamide. InChIKey: LTFVELCIFWEGGA-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 4-amino-N,N-diethylbenzenesulfonamide |
| InChIKey | LTFVELCIFWEGGA-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)