4-Aminoisoquinoline-1-carboxylic acid, 95+%
cas: 1260875-57-7 — see every product listed under this CAS number, including other names
4-Aminoisoquinoline-1-carboxylic acid, 95+% (CAS 1260875-57-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A617164-25mg |
| cas | 1260875-57-7 |
| size | 25mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 648.50 Pln | |
| Ambeed | 50mg | 1043.44 Pln | |
| Ambeed | 100mg | 1722.06 Pln | |
| Ambeed | 250mg | 3045.94 Pln | |
| Ambeed | 1g | 8091.12 Pln | |
| BLDpharm | 25mg | 692.00 Pln | |
| BLDpharm | 50mg | 1119.63 Pln | |
| BLDpharm | 100mg | 1852.71 Pln | |
| BLDpharm | 250mg | 3274.43 Pln | |
| BLDpharm | 1g | 8722.51 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
4-aminoisoquinoline-1-carboxylic acid (CAS 1260875-57-7) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 4-aminoisoquinoline-1-carboxylic acid. InChIKey: BNTKPWGXMRFVNV-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 4-aminoisoquinoline-1-carboxylic acid |
| InChIKey | BNTKPWGXMRFVNV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=C2C(=O)O)N |
Computed by PubChem (NCBI)