cas: 1421371-97-2 — see every product listed under this CAS number, including other names
4-BROMO-2-METHOXY-5-NITROANILINE, 97% (CAS 1421371-97-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F331200-100MG |
| cas | 1421371-97-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 325.94 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 2.5g | 1101.71 Pln | |
| Fluorochem | 5g | 1320.39 Pln | |
| Fluorochem | 10g | 2575.15 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-2-methoxy-5-nitroaniline (CAS 1421371-97-2) is a chemical compound with the molecular formula C7H7BrN2O3 and a molecular weight of 247.05 g/mol. IUPAC name: 4-bromo-2-methoxy-5-nitroaniline. InChIKey: AASIUWXCQAIDKA-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O3 |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 4-bromo-2-methoxy-5-nitroaniline |
| InChIKey | AASIUWXCQAIDKA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)