cas: 63242-14-8 — see every product listed under this CAS number, including other names
4-Benzoyl-4'-bromobiphenyl, >98.0%(GC) (CAS 63242-14-8) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B2720-25G |
| cas | 63242-14-8 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 231.44 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
[4-(4-bromophenyl)phenyl]-phenylmethanone (CAS 63242-14-8) is a chemical compound with the molecular formula C19H13BrO and a molecular weight of 337.2 g/mol. IUPAC name: [4-(4-bromophenyl)phenyl]-phenylmethanone. InChIKey: ITMLYLPKSFZCJK-UHFFFAOYSA-N.
| Molecular formula | C19H13BrO |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | [4-(4-bromophenyl)phenyl]-phenylmethanone |
| InChIKey | ITMLYLPKSFZCJK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)