CAS 63242-14-8 appears in our catalog under these names: 4-Benzoyl-4'-bromobiphenyl, 98%, 4–Benzoyl–4'–bromobiphenyl, 4-Benzoyl-4'-bromobiphenyl, >98.0%(GC). Offered by: Combi-blocks, GLPBio, TCI. Available pack sizes: 25g, 5g, 100g, 1g.
[4-(4-bromophenyl)phenyl]-phenylmethanone (CAS 63242-14-8) is a chemical compound with the molecular formula C19H13BrO and a molecular weight of 337.2 g/mol. IUPAC name: [4-(4-bromophenyl)phenyl]-phenylmethanone. InChIKey: ITMLYLPKSFZCJK-UHFFFAOYSA-N.
| Molecular formula | C19H13BrO |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | [4-(4-bromophenyl)phenyl]-phenylmethanone |
| InChIKey | ITMLYLPKSFZCJK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)