cas: 128102-16-9 — see every product listed under this CAS number, including other names
4-Benzyl 1-(tert-butyl) 2-methylpiperazine-1,4-dicarboxylate, 97% (CAS 128102-16-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F621726-100MG |
| cas | 128102-16-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 487.35 Pln | |
| Fluorochem | 250mg | 914.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-O-benzyl 1-O-tert-butyl (2R)-2-methylpiperazine-1,4-dicarboxylate (CAS 128102-16-9) is a chemical compound with the molecular formula C18H26N2O4 and a molecular weight of 334.4 g/mol. IUPAC name: 4-O-benzyl 1-O-tert-butyl (2R)-2-methylpiperazine-1,4-dicarboxylate. InChIKey: KEFLVDKHKWYORF-CQSZACIVSA-N.
| Molecular formula | C18H26N2O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 4-O-benzyl 1-O-tert-butyl (2R)-2-methylpiperazine-1,4-dicarboxylate |
| InChIKey | KEFLVDKHKWYORF-CQSZACIVSA-N |
| SMILES | C[C@@H]1CN(CCN1C(=O)OC(C)(C)C)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)