cas: 205672-20-4 — see every product listed under this CAS number, including other names
4-Benzyloxy-5-bromo-2-(N,N-dimethylamino)pyrimidine (CAS 205672-20-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633251-1G |
| cas | 205672-20-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 966.34 Pln | |
| Fluorochem | 5g | 2752.17 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-N,N-dimethyl-4-phenylmethoxypyrimidin-2-amine (CAS 205672-20-4) is a chemical compound with the molecular formula C13H14BrN3O and a molecular weight of 308.17 g/mol. IUPAC name: 5-bromo-N,N-dimethyl-4-phenylmethoxypyrimidin-2-amine. InChIKey: QJYQFOIWCQXMKE-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN3O |
|---|---|
| Molecular weight | 308.17 g/mol |
| IUPAC name | 5-bromo-N,N-dimethyl-4-phenylmethoxypyrimidin-2-amine |
| InChIKey | QJYQFOIWCQXMKE-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC=C(C(=N1)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)