CAS 1216013-09-0 is the registry number for 5-Bromo-2-N-[(4-methoxyphenyl)methyl]pyridine-2,3-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-bromo-2-N-[(4-methoxyphenyl)methyl]pyridine-2,3-diamine (CAS 1216013-09-0) is a chemical compound with the molecular formula C13H14BrN3O and a molecular weight of 308.17 g/mol. IUPAC name: 5-bromo-2-N-[(4-methoxyphenyl)methyl]pyridine-2,3-diamine. InChIKey: CEMMTRQJJRSUKV-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN3O |
|---|---|
| Molecular weight | 308.17 g/mol |
| IUPAC name | 5-bromo-2-N-[(4-methoxyphenyl)methyl]pyridine-2,3-diamine |
| InChIKey | CEMMTRQJJRSUKV-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CNC2=C(C=C(C=N2)Br)N |
Computed by PubChem (NCBI)