cas: 838-96-0 — see every product listed under this CAS number, including other names
4-Benzyloxyphenylacetonitrile, >98.0%(GC) (CAS 838-96-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B4734-1G |
| cas | 838-96-0 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 128.18 Pln | |
| TCI | 5g | 398.63 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
2-(4-phenylmethoxyphenyl)acetonitrile (CAS 838-96-0) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. IUPAC name: 2-(4-phenylmethoxyphenyl)acetonitrile. InChIKey: QKEYZRVDFZDOEP-UHFFFAOYSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 2-(4-phenylmethoxyphenyl)acetonitrile |
| InChIKey | QKEYZRVDFZDOEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)CC#N |
Computed by PubChem (NCBI)