CAS 110790-05-1 is the registry number for 4-Benzyloxyphenylacetonitrile-d2. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
2,2-dideuterio-2-(4-phenylmethoxyphenyl)acetonitrile (CAS 110790-05-1) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 225.28 g/mol. IUPAC name: 2,2-dideuterio-2-(4-phenylmethoxyphenyl)acetonitrile. InChIKey: QKEYZRVDFZDOEP-KBMKNGFXSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | 2,2-dideuterio-2-(4-phenylmethoxyphenyl)acetonitrile |
| InChIKey | QKEYZRVDFZDOEP-KBMKNGFXSA-N |
| SMILES | [2H]C([2H])(C#N)C1=CC=C(C=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)