cas: 126937-41-5 — see every product listed under this CAS number, including other names
4-Boc-1-Cbz-2-piperazinecarboxylic acid, 97%, 97% (CAS 126937-41-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111WFP-250mg |
| cas | 126937-41-5 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 10g | 290.00 Pln | |
| Chemat | 25g | 554.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperazine-2-carboxylic acid (CAS 126937-41-5) is a chemical compound with the molecular formula C18H24N2O6 and a molecular weight of 364.4 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperazine-2-carboxylic acid. InChIKey: MKXMXZZARNRMMQ-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O6 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperazine-2-carboxylic acid |
| InChIKey | MKXMXZZARNRMMQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C1)C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)