cas: 126937-41-5 — see every product listed under this CAS number, including other names
N-4-Boc-n-1-cbz-2-piperazine carboxylic acid, 95% (CAS 126937-41-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg, 25g, 100g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QC-2220-5g |
| cas | 126937-41-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 250mg | 174.96 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 263.47 Pln | |
| Fluorochem | 25g | 695.61 Pln | |
| Fluorochem | 100g | 2533.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperazine-2-carboxylic acid (CAS 126937-41-5) is a chemical compound with the molecular formula C18H24N2O6 and a molecular weight of 364.4 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperazine-2-carboxylic acid. InChIKey: MKXMXZZARNRMMQ-UHFFFAOYSA-N.
| Molecular formula | C18H24N2O6 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonyl]-1-phenylmethoxycarbonylpiperazine-2-carboxylic acid |
| InChIKey | MKXMXZZARNRMMQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C1)C(=O)O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)