cas: 335013-18-8 — see every product listed under this CAS number, including other names
4-Bromo-1-(bromomethyl)-2-(trifluoromethyl)benzene (CAS 335013-18-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F232932-100MG |
| cas | 335013-18-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 830.98 Pln | |
| Fluorochem | 10g | 1419.31 Pln | |
| Fluorochem | 25g | 3184.31 Pln |
| delivery time | 2-3 weeks |
|---|
4-bromo-1-(bromomethyl)-2-(trifluoromethyl)benzene (CAS 335013-18-8) is a chemical compound with the molecular formula C8H5Br2F3 and a molecular weight of 317.93 g/mol. IUPAC name: 4-bromo-1-(bromomethyl)-2-(trifluoromethyl)benzene. InChIKey: KYIYLQNLZYNVQY-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F3 |
|---|---|
| Molecular weight | 317.93 g/mol |
| IUPAC name | 4-bromo-1-(bromomethyl)-2-(trifluoromethyl)benzene |
| InChIKey | KYIYLQNLZYNVQY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(F)(F)F)CBr |
Computed by PubChem (NCBI)