cas: 335013-18-8 — see every product listed under this CAS number, including other names
4-Bromo-1-(BromoMethyl)-2-(Trifluoromethyl)Benzene, 98%, 98% (CAS 335013-18-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11491X-100mg |
| cas | 335013-18-8 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 520.40 Pln | |
| Chemat | 10g | 875.60 Pln | |
| Chemat | 25g | 1936.40 Pln | |
| Chemat | 100g | 6064.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-1-(bromomethyl)-2-(trifluoromethyl)benzene (CAS 335013-18-8) is a chemical compound with the molecular formula C8H5Br2F3 and a molecular weight of 317.93 g/mol. IUPAC name: 4-bromo-1-(bromomethyl)-2-(trifluoromethyl)benzene. InChIKey: KYIYLQNLZYNVQY-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F3 |
|---|---|
| Molecular weight | 317.93 g/mol |
| IUPAC name | 4-bromo-1-(bromomethyl)-2-(trifluoromethyl)benzene |
| InChIKey | KYIYLQNLZYNVQY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(F)(F)F)CBr |
Computed by PubChem (NCBI)