cas: 300356-32-5 — see every product listed under this CAS number, including other names
4-Bromo-1-(methylsulfonyl)-2-(trifluoromethyl)benzene, 98% (CAS 300356-32-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F213142-250MG |
| cas | 300356-32-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 1372.45 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-1-methylsulfonyl-2-(trifluoromethyl)benzene (CAS 300356-32-5) is a chemical compound with the molecular formula C8H6BrF3O2S and a molecular weight of 303.10 g/mol. IUPAC name: 4-bromo-1-methylsulfonyl-2-(trifluoromethyl)benzene. InChIKey: DJWJDMOGILQESS-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O2S |
|---|---|
| Molecular weight | 303.10 g/mol |
| IUPAC name | 4-bromo-1-methylsulfonyl-2-(trifluoromethyl)benzene |
| InChIKey | DJWJDMOGILQESS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)