cas: 300356-32-5 — see every product listed under this CAS number, including other names
5-Bromo-2-(methylsulfonyl)benzotrifluoride, 98%, 98% (CAS 300356-32-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BGXD-100mg |
| cas | 300356-32-5 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 1259.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-1-methylsulfonyl-2-(trifluoromethyl)benzene (CAS 300356-32-5) is a chemical compound with the molecular formula C8H6BrF3O2S and a molecular weight of 303.10 g/mol. IUPAC name: 4-bromo-1-methylsulfonyl-2-(trifluoromethyl)benzene. InChIKey: DJWJDMOGILQESS-UHFFFAOYSA-N.
| Molecular formula | C8H6BrF3O2S |
|---|---|
| Molecular weight | 303.10 g/mol |
| IUPAC name | 4-bromo-1-methylsulfonyl-2-(trifluoromethyl)benzene |
| InChIKey | DJWJDMOGILQESS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)