CAS 637022-52-7 is the registry number for 4–Bromo–1–chloro–2–isopropoxybenzene. Offered by: GLPBio. Available pack sizes: 10g, 1g, 5g.
4-bromo-1-chloro-2-propan-2-yloxybenzene (CAS 637022-52-7) is a chemical compound with the molecular formula C9H10BrClO and a molecular weight of 249.53 g/mol. IUPAC name: 4-bromo-1-chloro-2-propan-2-yloxybenzene. InChIKey: JJGQFOSYETWZLC-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClO |
|---|---|
| Molecular weight | 249.53 g/mol |
| IUPAC name | 4-bromo-1-chloro-2-propan-2-yloxybenzene |
| InChIKey | JJGQFOSYETWZLC-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=CC(=C1)Br)Cl |
Computed by PubChem (NCBI)