CAS 2055841-45-5 is the registry number for 8-Bromochroman hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
8-bromo-3,4-dihydro-2H-chromene;hydrochloride (CAS 2055841-45-5) is a chemical compound with the molecular formula C9H10BrClO and a molecular weight of 249.53 g/mol. IUPAC name: 8-bromo-3,4-dihydro-2H-chromene;hydrochloride. InChIKey: HNUCQXHVXHPHLB-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClO |
|---|---|
| Molecular weight | 249.53 g/mol |
| IUPAC name | 8-bromo-3,4-dihydro-2H-chromene;hydrochloride |
| InChIKey | HNUCQXHVXHPHLB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC=C2)Br)OC1.Cl |
Computed by PubChem (NCBI)