cas: 53965-69-8 — see every product listed under this CAS number, including other names
4-Bromo-2,3,5,6-tetramethylaniline, 97%, 97% (CAS 53965-69-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DKFV-100mg |
| cas | 53965-69-8 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 760.40 Pln | |
| Chemat | 5g | 2190.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2,3,5,6-tetramethylaniline (CAS 53965-69-8) is a chemical compound with the molecular formula C10H14BrN and a molecular weight of 228.13 g/mol. IUPAC name: 4-bromo-2,3,5,6-tetramethylaniline. InChIKey: VENKISSLGWHCOE-UHFFFAOYSA-N.
| Molecular formula | C10H14BrN |
|---|---|
| Molecular weight | 228.13 g/mol |
| IUPAC name | 4-bromo-2,3,5,6-tetramethylaniline |
| InChIKey | VENKISSLGWHCOE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1N)C)C)Br)C |
Computed by PubChem (NCBI)