CAS 53965-69-8 appears in our catalog under these names: 4-Bromo-2,3,5,6-tetramethylaniline, 97%, 4–Bromo–2,3,5,6–tetramethylaniline, 4-Bromo-2,3,5,6-tetramethylaniline 97%, 4-Bromo-2,3,5,6-tetramethylaniline, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
4-bromo-2,3,5,6-tetramethylaniline (CAS 53965-69-8) is a chemical compound with the molecular formula C10H14BrN and a molecular weight of 228.13 g/mol. IUPAC name: 4-bromo-2,3,5,6-tetramethylaniline. InChIKey: VENKISSLGWHCOE-UHFFFAOYSA-N.
| Molecular formula | C10H14BrN |
|---|---|
| Molecular weight | 228.13 g/mol |
| IUPAC name | 4-bromo-2,3,5,6-tetramethylaniline |
| InChIKey | VENKISSLGWHCOE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1N)C)C)Br)C |
Computed by PubChem (NCBI)