cas: 626238-73-1 — see every product listed under this CAS number, including other names
4-Bromo-2,3-difluoro-6-nitroaniline, 98%, 98% (CAS 626238-73-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EKPZ-100mg |
| cas | 626238-73-1 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 500mg | 429.20 Pln | |
| Chemat | 1g | 486.80 Pln | |
| Chemat | 5g | 1398.80 Pln | |
| Chemat | 10g | 2728.40 Pln | |
| Chemat | 25g | 4806.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2,3-difluoro-6-nitroaniline (CAS 626238-73-1) is a chemical compound with the molecular formula C6H3BrF2N2O2 and a molecular weight of 253.00 g/mol. IUPAC name: 4-bromo-2,3-difluoro-6-nitroaniline. InChIKey: UEQDRXXHEPIYMV-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF2N2O2 |
|---|---|
| Molecular weight | 253.00 g/mol |
| IUPAC name | 4-bromo-2,3-difluoro-6-nitroaniline |
| InChIKey | UEQDRXXHEPIYMV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)F)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)