CAS 1807076-85-2 is the registry number for 2-Bromo-5-(difluoromethyl)-3-nitropyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5-(difluoromethyl)-3-nitropyridine (CAS 1807076-85-2) is a chemical compound with the molecular formula C6H3BrF2N2O2 and a molecular weight of 253.00 g/mol. IUPAC name: 2-bromo-5-(difluoromethyl)-3-nitropyridine. InChIKey: NQYNMKVZYFWOHM-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF2N2O2 |
|---|---|
| Molecular weight | 253.00 g/mol |
| IUPAC name | 2-bromo-5-(difluoromethyl)-3-nitropyridine |
| InChIKey | NQYNMKVZYFWOHM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1[N+](=O)[O-])Br)C(F)F |
Computed by PubChem (NCBI)