cas: 1357476-67-5 — see every product listed under this CAS number, including other names
4-Bromo-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine 98% (CAS 1357476-67-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A158771-100mg |
| cas | 1357476-67-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 804.25 Pln | |
| Ambeed | 250mg | 1304.88 Pln | |
| Ambeed | 1g | 3413.06 Pln | |
| Ambeed | 5g | 11767.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A158771 |
4-bromo-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine (CAS 1357476-67-5) is a chemical compound with the molecular formula C9H9BrF3N and a molecular weight of 268.07 g/mol. IUPAC name: 4-bromo-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine. InChIKey: XAQNICQGPIHIIH-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF3N |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | 4-bromo-2-(1,1,1-trifluoro-2-methylpropan-2-yl)pyridine |
| InChIKey | XAQNICQGPIHIIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC=CC(=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)