CAS 2852769-74-3 is the registry number for 2-Bromo-4,6-dimethyl-3-(trifluoromethyl)aniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4,6-dimethyl-3-(trifluoromethyl)aniline (CAS 2852769-74-3) is a chemical compound with the molecular formula C9H9BrF3N and a molecular weight of 268.07 g/mol. IUPAC name: 2-bromo-4,6-dimethyl-3-(trifluoromethyl)aniline. InChIKey: MHLGYKXZAVCBSC-UHFFFAOYSA-N.
| Molecular formula | C9H9BrF3N |
|---|---|
| Molecular weight | 268.07 g/mol |
| IUPAC name | 2-bromo-4,6-dimethyl-3-(trifluoromethyl)aniline |
| InChIKey | MHLGYKXZAVCBSC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(F)(F)F)Br)N)C |
Computed by PubChem (NCBI)