cas: 1078734-03-8 — see every product listed under this CAS number, including other names
4-Bromo-2-(4-methoxyphenyl)thiazole, 97%, 97% (CAS 1078734-03-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DO52-50mg |
| cas | 1078734-03-8 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 611.60 Pln | |
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1442.00 Pln | |
| Chemat | 1g | 2819.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-(4-methoxyphenyl)-1,3-thiazole (CAS 1078734-03-8) is a chemical compound with the molecular formula C10H8BrNOS and a molecular weight of 270.15 g/mol. IUPAC name: 4-bromo-2-(4-methoxyphenyl)-1,3-thiazole. InChIKey: MUNWKDJOWYMCTP-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNOS |
|---|---|
| Molecular weight | 270.15 g/mol |
| IUPAC name | 4-bromo-2-(4-methoxyphenyl)-1,3-thiazole |
| InChIKey | MUNWKDJOWYMCTP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=CS2)Br |
Computed by PubChem (NCBI)