CAS 356552-30-2 is the registry number for (4-Bromophenyl)(thiazol-2-yl)methanol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
(4-bromophenyl)-(1,3-thiazol-2-yl)methanol (CAS 356552-30-2) is a chemical compound with the molecular formula C10H8BrNOS and a molecular weight of 270.15 g/mol. IUPAC name: (4-bromophenyl)-(1,3-thiazol-2-yl)methanol. InChIKey: WJQRNBMHNPHGCA-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNOS |
|---|---|
| Molecular weight | 270.15 g/mol |
| IUPAC name | (4-bromophenyl)-(1,3-thiazol-2-yl)methanol |
| InChIKey | WJQRNBMHNPHGCA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=NC=CS2)O)Br |
Computed by PubChem (NCBI)