cas: 158579-80-7 — see every product listed under this CAS number, including other names
4-Bromo-2-chloro-1-(trifluoromethoxy)benzene 98% (CAS 158579-80-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A413382-10g |
| cas | 158579-80-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 236.88 Pln | |
| Ambeed | 25g | 442.69 Pln | |
| Ambeed | 100g | 1482.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A413382 |
4-bromo-2-chloro-1-(trifluoromethoxy)benzene (CAS 158579-80-7) is a chemical compound with the molecular formula C7H3BrClF3O and a molecular weight of 275.45 g/mol. IUPAC name: 4-bromo-2-chloro-1-(trifluoromethoxy)benzene. InChIKey: WSENYRJAJFHXQR-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3O |
|---|---|
| Molecular weight | 275.45 g/mol |
| IUPAC name | 4-bromo-2-chloro-1-(trifluoromethoxy)benzene |
| InChIKey | WSENYRJAJFHXQR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)