cas: 870703-71-2 — see every product listed under this CAS number, including other names
4-Bromo-2-chloro-6-(trifluoromethyl)aniline 95% (CAS 870703-71-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A461549-1g |
| cas | 870703-71-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 648.50 Pln | |
| Ambeed | 25g | 1905.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A461549 |
4-bromo-2-chloro-6-(trifluoromethyl)aniline (CAS 870703-71-2) is a chemical compound with the molecular formula C7H4BrClF3N and a molecular weight of 274.46 g/mol. IUPAC name: 4-bromo-2-chloro-6-(trifluoromethyl)aniline. InChIKey: GAOGWONUOUYZFD-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF3N |
|---|---|
| Molecular weight | 274.46 g/mol |
| IUPAC name | 4-bromo-2-chloro-6-(trifluoromethyl)aniline |
| InChIKey | GAOGWONUOUYZFD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)N)Cl)Br |
Computed by PubChem (NCBI)