cas: 870703-71-2 — see every product listed under this CAS number, including other names
4-Bromo-2-chloro-6-(trifluoromethyl)aniline (CAS 870703-71-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034785-10G |
| cas | 870703-71-2 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 1060.06 Pln | |
| Fluorochem | 5g | 653.95 Pln |
| delivery time | 3-4 weeks |
|---|
4-bromo-2-chloro-6-(trifluoromethyl)aniline (CAS 870703-71-2) is a chemical compound with the molecular formula C7H4BrClF3N and a molecular weight of 274.46 g/mol. IUPAC name: 4-bromo-2-chloro-6-(trifluoromethyl)aniline. InChIKey: GAOGWONUOUYZFD-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF3N |
|---|---|
| Molecular weight | 274.46 g/mol |
| IUPAC name | 4-bromo-2-chloro-6-(trifluoromethyl)aniline |
| InChIKey | GAOGWONUOUYZFD-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)N)Cl)Br |
Computed by PubChem (NCBI)