cas: 87547-06-6 — see every product listed under this CAS number, including other names
4-Bromo-2-fluoro-5-nitroaniline, 96% (CAS 87547-06-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211556-1G |
| cas | 87547-06-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 409.25 Pln | |
| Fluorochem | 10g | 763.29 Pln | |
| Fluorochem | 25g | 1388.07 Pln | |
| Fluorochem | 100g | 4475.53 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
4-bromo-2-fluoro-5-nitroaniline (CAS 87547-06-6) is a chemical compound with the molecular formula C6H4BrFN2O2 and a molecular weight of 235.01 g/mol. IUPAC name: 4-bromo-2-fluoro-5-nitroaniline. InChIKey: PDNZCDDWSKYNTE-UHFFFAOYSA-N.
| Molecular formula | C6H4BrFN2O2 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 4-bromo-2-fluoro-5-nitroaniline |
| InChIKey | PDNZCDDWSKYNTE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Br)F)N |
Computed by PubChem (NCBI)