cas: 1490694-65-9 — see every product listed under this CAS number, including other names
4-Bromo-2-isobutoxyaniline, 95% (CAS 1490694-65-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F697777-100MG |
| cas | 1490694-65-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 794.53 Pln | |
| Fluorochem | 250mg | 1372.45 Pln | |
| Fluorochem | 1g | 2231.52 Pln | |
| Fluorochem | 5g | 6370.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-2-(2-methylpropoxy)aniline (CAS 1490694-65-9) is a chemical compound with the molecular formula C10H14BrNO and a molecular weight of 244.13 g/mol. IUPAC name: 4-bromo-2-(2-methylpropoxy)aniline. InChIKey: WBUJEFCQOZCVRA-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO |
|---|---|
| Molecular weight | 244.13 g/mol |
| IUPAC name | 4-bromo-2-(2-methylpropoxy)aniline |
| InChIKey | WBUJEFCQOZCVRA-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=C(C=CC(=C1)Br)N |
Computed by PubChem (NCBI)