cas: 145915-29-3 — see every product listed under this CAS number, including other names
4-Bromo-2-methoxybenzenesulfonyl chloride, 95% (CAS 145915-29-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037987-100MG |
| cas | 145915-29-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 346.77 Pln | |
| Fluorochem | 250mg | 591.48 Pln | |
| Fluorochem | 1g | 1393.28 Pln | |
| Fluorochem | 5g | 4860.81 Pln | |
| Fluorochem | 10g | 8744.86 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-2-methoxybenzenesulfonyl chloride (CAS 145915-29-3) is a chemical compound with the molecular formula C7H6BrClO3S and a molecular weight of 285.54 g/mol. IUPAC name: 4-bromo-2-methoxybenzenesulfonyl chloride. InChIKey: QPPCLNMOYHCXMS-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO3S |
|---|---|
| Molecular weight | 285.54 g/mol |
| IUPAC name | 4-bromo-2-methoxybenzenesulfonyl chloride |
| InChIKey | QPPCLNMOYHCXMS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)