CAS 23095-05-8 appears in our catalog under these names: 5-Bromo-2-methoxybenzene-1-sulfonyl chloride, 95%, 5–Bromo–2–methoxybenzenesulfonyl chloride, 5-Bromo-2-methoxybenzenesulfonyl chloride, 98% , 5-Bromo-2-methoxybenzenesulfonyl Chloride, >97.0%(GC)(T), 5-Bromo-2-methoxybenzenesulfonyl chloride 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 25g, 5g, 100g, 1g.
5-bromo-2-methoxybenzenesulfonyl chloride (CAS 23095-05-8) is a chemical compound with the molecular formula C7H6BrClO3S and a molecular weight of 285.54 g/mol. IUPAC name: 5-bromo-2-methoxybenzenesulfonyl chloride. InChIKey: IXSBNNRUQYYMRM-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClO3S |
|---|---|
| Molecular weight | 285.54 g/mol |
| IUPAC name | 5-bromo-2-methoxybenzenesulfonyl chloride |
| InChIKey | IXSBNNRUQYYMRM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)