cas: 99768-21-5 — see every product listed under this CAS number, including other names
4-Bromo-2-methyl-1-(methylsulfonyl)benzene, 98% (CAS 99768-21-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F244207-250MG |
| cas | 99768-21-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 825.77 Pln | |
| Fluorochem | 5g | 2715.73 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-2-methyl-1-methylsulfonylbenzene (CAS 99768-21-5) is a chemical compound with the molecular formula C8H9BrO2S and a molecular weight of 249.13 g/mol. IUPAC name: 4-bromo-2-methyl-1-methylsulfonylbenzene. InChIKey: LNVYXKNXYRIPOR-UHFFFAOYSA-N.
| Molecular formula | C8H9BrO2S |
|---|---|
| Molecular weight | 249.13 g/mol |
| IUPAC name | 4-bromo-2-methyl-1-methylsulfonylbenzene |
| InChIKey | LNVYXKNXYRIPOR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)S(=O)(=O)C |
Computed by PubChem (NCBI)