cas: 71785-48-3 — see every product listed under this CAS number, including other names
4-Bromo-2-methyl-5-nitroaniline, 95% (CAS 71785-48-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F037682-1G |
| cas | 71785-48-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 25g | 2314.83 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-bromo-2-methyl-5-nitroaniline (CAS 71785-48-3) is a chemical compound with the molecular formula C7H7BrN2O2 and a molecular weight of 231.05 g/mol. IUPAC name: 4-bromo-2-methyl-5-nitroaniline. InChIKey: VNSOWZDCHBKTGR-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O2 |
|---|---|
| Molecular weight | 231.05 g/mol |
| IUPAC name | 4-bromo-2-methyl-5-nitroaniline |
| InChIKey | VNSOWZDCHBKTGR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)