Products 886373-11-1

CAS 886373-11-1 is the registry number for (3-Amino-5-bromopyridin-2-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-(3-amino-5-bromo-2-pyridinyl)acetic acid (CAS 886373-11-1) is a chemical compound with the molecular formula C7H7BrN2O2 and a molecular weight of 231.05 g/mol. IUPAC name: 2-(3-amino-5-bromo-2-pyridinyl)acetic acid. InChIKey: RLXAYGGCRBEJQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BrN2O2
Molecular weight231.05 g/mol
IUPAC name2-(3-amino-5-bromo-2-pyridinyl)acetic acid
InChIKeyRLXAYGGCRBEJQZ-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1N)CC(=O)O)Br

Computed by PubChem (NCBI)