cas: 1344291-11-7 — see every product listed under this CAS number, including other names
4-Bromo-2-methyl-n-propylbenzamide, 95% (CAS 1344291-11-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1162275-25g |
| cas | 1344291-11-7 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 20381.20 Pln | |
| AmBeed | 10g | 10225.60 Pln | |
| AmBeed | 5g | 6417.25 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-bromo-2-methyl-N-propylbenzamide (CAS 1344291-11-7) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: 4-bromo-2-methyl-N-propylbenzamide. InChIKey: TTYFGRNPVFZCEU-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | 4-bromo-2-methyl-N-propylbenzamide |
| InChIKey | TTYFGRNPVFZCEU-UHFFFAOYSA-N |
| SMILES | CCCNC(=O)C1=C(C=C(C=C1)Br)C |
Computed by PubChem (NCBI)