Products 1375069-10-5
CAS 1375069-10-5 appears in our catalog under these names: 2-Bromo-6-(diethylamino)benzaldehyde, 98%, 2-Bromo-6-(diethylamino)benzaldehyde. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 10g, 5g, 25g.
2-bromo-6-(diethylamino)benzaldehyde (CAS 1375069-10-5) is a chemical compound with the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. IUPAC name: 2-bromo-6-(diethylamino)benzaldehyde. InChIKey: GLTJYNBDAQXFLL-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO |
|---|---|
| Molecular weight | 256.14 g/mol |
| IUPAC name | 2-bromo-6-(diethylamino)benzaldehyde |
| InChIKey | GLTJYNBDAQXFLL-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=C(C(=CC=C1)Br)C=O |
Computed by PubChem (NCBI)