cas: 1255574-47-0 — see every product listed under this CAS number, including other names
4-Bromo-2-nitro-5-octyloxyaniline, 95%, 95% (CAS 1255574-47-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111NUF-1g |
| cas | 1255574-47-0 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1298.00 Pln | |
| Chemat | 5g | 4427.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2-nitro-5-octoxyaniline (CAS 1255574-47-0) is a chemical compound with the molecular formula C14H21BrN2O3 and a molecular weight of 345.23 g/mol. IUPAC name: 4-bromo-2-nitro-5-octoxyaniline. InChIKey: XPZPTCBPSUTRHV-UHFFFAOYSA-N.
| Molecular formula | C14H21BrN2O3 |
|---|---|
| Molecular weight | 345.23 g/mol |
| IUPAC name | 4-bromo-2-nitro-5-octoxyaniline |
| InChIKey | XPZPTCBPSUTRHV-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC1=C(C=C(C(=C1)N)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)